About (E)-4-chloro-N,N-diethylpent-2-enamide
(E)-4-chloro-N,N-diethylpent-2-enamide (PubChem CID 18799937) has the molecular formula C9H16ClNO
and a molecular weight of 189.69 g/mol. Its IUPAC name is (E)-4-chloro-N,N-diethylpent-2-enamide.
Molecular Properties
| Compound Name | (E)-4-chloro-N,N-diethylpent-2-enamide |
| PubChem CID | 18799937 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (E)-4-chloro-N,N-diethylpent-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/C(C)Cl |
| InChI | InChI=1S/C9H16ClNO/c1-4-11(5-2)9(12)7-6-8(3)10/h6-8H,4-5H2,1-3H3/b7-6+ |
| InChIKey | ZZPGFFRMBXEUQF-VOTSOKGWSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-chloro-N,N-diethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-chloro-N,N-diethylpent-2-enamide?
The IUPAC name of (E)-4-chloro-N,N-diethylpent-2-enamide (CID 18799937) is (E)-4-chloro-N,N-diethylpent-2-enamide.
What is the SMILES notation for (E)-4-chloro-N,N-diethylpent-2-enamide?
The canonical SMILES for (E)-4-chloro-N,N-diethylpent-2-enamide is CCN(CC)C(=O)/C=C/C(C)Cl.
What is the InChIKey of (E)-4-chloro-N,N-diethylpent-2-enamide?
The InChIKey is ZZPGFFRMBXEUQF-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H16ClNO/c1-4-11(5-2)9(12)7-6-8(3)10/h6-8H,4-5H2,1-3H3/b7-6+.
What are the key properties of (E)-4-chloro-N,N-diethylpent-2-enamide?
(E)-4-chloro-N,N-diethylpent-2-enamide has a molecular weight of 189.69 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-chloro-N,N-diethylpent-2-enamide is sourced from PubChem (CID 18799937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).