C12H22N2O — CID 18799998
N-ethylethanamine;2-(4-methyl-2-pyridinyl)ethanol (PubChem CID 18799998) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-ethylethanamine;2-(4-methyl-2-pyridinyl)ethanol.
| Compound Name | N-ethylethanamine;2-(4-methyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 18799998 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-ethylethanamine;2-(4-methyl-2-pyridinyl)ethanol |
| SMILES | CCNCC.Cc1ccnc(CCO)c1 |
| InChI | InChI=1S/C8H11NO.C4H11N/c1-7-2-4-9-8(6-7)3-5-10;1-3-5-4-2/h2,4,6,10H,3,5H2,1H3;5H,3-4H2,1-2H3 |
| InChIKey | DDYSHJDEWZXEHD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |