C25H27F2NO3 — CID 18801057
N-[2,4-difluoro-6-[2-[4-(4-methoxyoxan-4-yl)phenyl]ethynyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 18801057) has the molecular formula C25H27F2NO3 and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[2,4-difluoro-6-[2-[4-(4-methoxyoxan-4-yl)phenyl]ethynyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2,4-difluoro-6-[2-[4-(4-methoxyoxan-4-yl)phenyl]ethynyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18801057 |
| Molecular Formula | C25H27F2NO3 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[2,4-difluoro-6-[2-[4-(4-methoxyoxan-4-yl)phenyl]ethynyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | COC1(c2ccc(C#Cc3cc(F)cc(F)c3NC(=O)C(C)(C)C)cc2)CCOCC1 |
| InChI | InChI=1S/C25H27F2NO3/c1-24(2,3)23(29)28-22-18(15-20(26)16-21(22)27)8-5-17-6-9-19(10-7-17)25(30-4)11-13-31-14-12-25/h6-7,9-10,15-16H,11-14H2,1-4H3,(H,28,29) |
| InChIKey | XPIHPPMTRGIGPL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|