About N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine
N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine (PubChem CID 18801473) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine.
Molecular Properties
| Compound Name | N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine |
| PubChem CID | 18801473 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine |
| SMILES | C/C=N/C1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO2S/c1-3-8-7(2)4-5-11(9,10)6-7/h3H,4-6H2,1-2H3/b8-3+ |
| InChIKey | QTFLBBDFUMTLJD-FPYGCLRLSA-N |
| XLogP | 0.65 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine?
The IUPAC name of N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine (CID 18801473) is N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine.
What is the SMILES notation for N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine?
The canonical SMILES for N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine is C/C=N/C1(C)CCS(=O)(=O)C1.
What is the InChIKey of N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine?
The InChIKey is QTFLBBDFUMTLJD-FPYGCLRLSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-3-8-7(2)4-5-11(9,10)6-7/h3H,4-6H2,1-2H3/b8-3+.
What are the key properties of N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine?
N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine has a molecular weight of 175.25 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,1-dioxothiolan-3-yl)ethanimine is sourced from PubChem (CID 18801473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).