C17H13Cl2NO4 — CID 18802292
1-[3-(2,5-dichlorophenoxy)propyl]-3,1-benzoxazine-2,4-dione (PubChem CID 18802292) has the molecular formula C17H13Cl2NO4 and a molecular weight of 366.20 g/mol. Its IUPAC name is 1-[3-(2,5-dichlorophenoxy)propyl]-3,1-benzoxazine-2,4-dione.
| Compound Name | 1-[3-(2,5-dichlorophenoxy)propyl]-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 18802292 |
| Molecular Formula | C17H13Cl2NO4 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 1-[3-(2,5-dichlorophenoxy)propyl]-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1oc(=O)n(CCCOc2cc(Cl)ccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C17H13Cl2NO4/c18-11-6-7-13(19)15(10-11)23-9-3-8-20-14-5-2-1-4-12(14)16(21)24-17(20)22/h1-2,4-7,10H,3,8-9H2 |
| InChIKey | XQFDSSOIPMPCMT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|