C17H17BrClNO3 — CID 18802988
5-bromo-2-[2-(4-chloro-3,5-dimethylphenoxy)ethylamino]benzoic acid (PubChem CID 18802988) has the molecular formula C17H17BrClNO3 and a molecular weight of 398.68 g/mol. Its IUPAC name is 5-bromo-2-[2-(4-chloro-3,5-dimethylphenoxy)ethylamino]benzoic acid.
| Compound Name | 5-bromo-2-[2-(4-chloro-3,5-dimethylphenoxy)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 18802988 |
| Molecular Formula | C17H17BrClNO3 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 5-bromo-2-[2-(4-chloro-3,5-dimethylphenoxy)ethylamino]benzoic acid |
| SMILES | Cc1cc(OCCNc2ccc(Br)cc2C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C17H17BrClNO3/c1-10-7-13(8-11(2)16(10)19)23-6-5-20-15-4-3-12(18)9-14(15)17(21)22/h3-4,7-9,20H,5-6H2,1-2H3,(H,21,22) |
| InChIKey | RQEWIMSEGOHZJK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|