About 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione
7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione (PubChem CID 18803550) has the molecular formula C19H18ClNO3
and a molecular weight of 343.81 g/mol. Its IUPAC name is 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione.
Molecular Properties
| Compound Name | 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione |
| PubChem CID | 18803550 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione |
| SMILES | Cc1ccc(OCCCN2C(=O)C(=O)c3cccc(Cl)c32)cc1C |
| InChI | InChI=1S/C19H18ClNO3/c1-12-7-8-14(11-13(12)2)24-10-4-9-21-17-15(18(22)19(21)23)5-3-6-16(17)20/h3,5-8,11H,4,9-10H2,1-2H3 |
| InChIKey | CWMYYFTVVOXFLO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione?
The IUPAC name of 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione (CID 18803550) is 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione.
What is the SMILES notation for 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione?
The canonical SMILES for 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione is Cc1ccc(OCCCN2C(=O)C(=O)c3cccc(Cl)c32)cc1C.
What is the InChIKey of 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione?
The InChIKey is CWMYYFTVVOXFLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNO3/c1-12-7-8-14(11-13(12)2)24-10-4-9-21-17-15(18(22)19(21)23)5-3-6-16(17)20/h3,5-8,11H,4,9-10H2,1-2H3.
What are the key properties of 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione?
7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione has a molecular weight of 343.81 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-[3-(3,4-dimethylphenoxy)propyl]indole-2,3-dione is sourced from PubChem (CID 18803550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).