About 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione
5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione (PubChem CID 18803804) has the molecular formula C16H9Cl4NO3
and a molecular weight of 405.06 g/mol. Its IUPAC name is 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione.
Molecular Properties
| Compound Name | 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione |
| PubChem CID | 18803804 |
| Molecular Formula | C16H9Cl4NO3 |
| Molecular Weight | 405.06 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCOc2cc(Cl)cc(Cl)c2)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C16H9Cl4NO3/c17-8-3-9(18)5-11(4-8)24-2-1-21-14-12(15(22)16(21)23)6-10(19)7-13(14)20/h3-7H,1-2H2 |
| InChIKey | TXUGQXHEYCOFIG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.06 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione?
The IUPAC name of 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione (CID 18803804) is 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione.
What is the SMILES notation for 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione?
The canonical SMILES for 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione is O=C1C(=O)N(CCOc2cc(Cl)cc(Cl)c2)c2c(Cl)cc(Cl)cc21.
What is the InChIKey of 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione?
The InChIKey is TXUGQXHEYCOFIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl4NO3/c17-8-3-9(18)5-11(4-8)24-2-1-21-14-12(15(22)16(21)23)6-10(19)7-13(14)20/h3-7H,1-2H2.
What are the key properties of 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione?
5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione has a molecular weight of 405.06 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-1-[2-(3,5-dichlorophenoxy)ethyl]indole-2,3-dione is sourced from PubChem (CID 18803804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).