C24H19N5O5S — CID 18804116
2-[(2E)-3-(4-hydroxyphenyl)-2-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 18804116) has the molecular formula C24H19N5O5S and a molecular weight of 489.51 g/mol. Its IUPAC name is 2-[(2E)-3-(4-hydroxyphenyl)-2-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(2E)-3-(4-hydroxyphenyl)-2-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 18804116 |
| Molecular Formula | C24H19N5O5S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-[(2E)-3-(4-hydroxyphenyl)-2-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(CC1S/C(=N/N=C/c2cccc([N+](=O)[O-])c2)N(c2ccc(O)cc2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H19N5O5S/c30-20-11-9-18(10-12-20)28-23(32)21(14-22(31)26-17-6-2-1-3-7-17)35-24(28)27-25-15-16-5-4-8-19(13-16)29(33)34/h1-13,15,21,30H,14H2,(H,26,31)/b25-15+,27-24+ |
| InChIKey | IKQSXAMUKGFMRG-WWNVFSHASA-N |
| XLogP | 4.17 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|