C21H31NO6 — CID 18805129
N-[(4aR,6S,7R,8R,8aS)-6-(4-butan-2-ylphenoxy)-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 18805129) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[(4aR,6S,7R,8R,8aS)-6-(4-butan-2-ylphenoxy)-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(4aR,6S,7R,8R,8aS)-6-(4-butan-2-ylphenoxy)-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 18805129 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[(4aR,6S,7R,8R,8aS)-6-(4-butan-2-ylphenoxy)-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CCC(C)c1ccc(O[C@@H]2O[C@@H]3COC(C)(C)O[C@H]3[C@H](O)[C@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C21H31NO6/c1-6-12(2)14-7-9-15(10-8-14)26-20-17(22-13(3)23)18(24)19-16(27-20)11-25-21(4,5)28-19/h7-10,12,16-20,24H,6,11H2,1-5H3,(H,22,23)/t12?,16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | PSLWVVTWBIKPJU-WWJPLCTCSA-N |
| XLogP | 2.32 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |