C28H29N5O4S2 — CID 18805188
ethyl 4-[7-methyl-4-oxo-3-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyrido[1,2-a]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 18805188) has the molecular formula C28H29N5O4S2 and a molecular weight of 563.71 g/mol. Its IUPAC name is ethyl 4-[7-methyl-4-oxo-3-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyrido[1,2-a]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[7-methyl-4-oxo-3-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyrido[1,2-a]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18805188 |
| Molecular Formula | C28H29N5O4S2 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | ethyl 4-[7-methyl-4-oxo-3-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyrido[1,2-a]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc3ccc(C)cn3c(=O)c2/C=C2/SC(=S)N(CCc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C28H29N5O4S2/c1-3-37-27(36)31-15-13-30(14-16-31)24-21(25(34)33-18-19(2)9-10-23(33)29-24)17-22-26(35)32(28(38)39-22)12-11-20-7-5-4-6-8-20/h4-10,17-18H,3,11-16H2,1-2H3/b22-17+ |
| InChIKey | JTQKSXCGHMQGAG-OQKWZONESA-N |
| XLogP | 3.73 |
| TPSA | 87.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|