C26H26N4O3S2 — CID 18805393
(5E)-3-benzyl-5-[[2-(2,6-dimethylmorpholin-4-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18805393) has the molecular formula C26H26N4O3S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[2-(2,6-dimethylmorpholin-4-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[[2-(2,6-dimethylmorpholin-4-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18805393 |
| Molecular Formula | C26H26N4O3S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | (5E)-3-benzyl-5-[[2-(2,6-dimethylmorpholin-4-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc2nc(N3CC(C)OC(C)C3)c(/C=C3/SC(=S)N(Cc4ccccc4)C3=O)c(=O)n2c1 |
| InChI | InChI=1S/C26H26N4O3S2/c1-16-9-10-22-27-23(28-13-17(2)33-18(3)14-28)20(24(31)29(22)12-16)11-21-25(32)30(26(34)35-21)15-19-7-5-4-6-8-19/h4-12,17-18H,13-15H2,1-3H3/b21-11+ |
| InChIKey | OQSCBSGHMVCUER-SRZZPIQSSA-N |
| XLogP | 4.02 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|