C26H25ClN4O2S2 — CID 18805703
(5E)-3-[(2-chlorophenyl)methyl]-5-[[9-methyl-2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18805703) has the molecular formula C26H25ClN4O2S2 and a molecular weight of 525.10 g/mol. Its IUPAC name is (5E)-3-[(2-chlorophenyl)methyl]-5-[[9-methyl-2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(2-chlorophenyl)methyl]-5-[[9-methyl-2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18805703 |
| Molecular Formula | C26H25ClN4O2S2 |
| Molecular Weight | 525.10 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | (5E)-3-[(2-chlorophenyl)methyl]-5-[[9-methyl-2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccn2c(=O)c(/C=C3/SC(=S)N(Cc4ccccc4Cl)C3=O)c(N3CCC(C)CC3)nc12 |
| InChI | InChI=1S/C26H25ClN4O2S2/c1-16-9-12-29(13-10-16)23-19(24(32)30-11-5-6-17(2)22(30)28-23)14-21-25(33)31(26(34)35-21)15-18-7-3-4-8-20(18)27/h3-8,11,14,16H,9-10,12-13,15H2,1-2H3/b21-14+ |
| InChIKey | PNIISRLRDMLAFH-KGENOOAVSA-N |
| XLogP | 5.29 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.10 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|