C24H21FN4O2S2 — CID 18805720
(5E)-3-[(4-fluorophenyl)methyl]-5-[(7-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18805720) has the molecular formula C24H21FN4O2S2 and a molecular weight of 480.59 g/mol. Its IUPAC name is (5E)-3-[(4-fluorophenyl)methyl]-5-[(7-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(4-fluorophenyl)methyl]-5-[(7-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18805720 |
| Molecular Formula | C24H21FN4O2S2 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | (5E)-3-[(4-fluorophenyl)methyl]-5-[(7-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc2nc(N3CCCC3)c(/C=C3/SC(=S)N(Cc4ccc(F)cc4)C3=O)c(=O)n2c1 |
| InChI | InChI=1S/C24H21FN4O2S2/c1-15-4-9-20-26-21(27-10-2-3-11-27)18(22(30)28(20)13-15)12-19-23(31)29(24(32)33-19)14-16-5-7-17(25)8-6-16/h4-9,12-13H,2-3,10-11,14H2,1H3/b19-12+ |
| InChIKey | SIXMHEDKUXEUDJ-XDHOZWIPSA-N |
| XLogP | 4.14 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|