C20H15ClF3N3O4S — CID 18807644
N-(4-chlorophenyl)-2-[2,4-dioxo-3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 18807644) has the molecular formula C20H15ClF3N3O4S and a molecular weight of 485.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2,4-dioxo-3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2,4-dioxo-3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 18807644 |
| Molecular Formula | C20H15ClF3N3O4S |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2,4-dioxo-3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1SC(=O)N(CC(=O)Nc2ccccc2C(F)(F)F)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClF3N3O4S/c21-11-5-7-12(8-6-11)25-16(28)9-15-18(30)27(19(31)32-15)10-17(29)26-14-4-2-1-3-13(14)20(22,23)24/h1-8,15H,9-10H2,(H,25,28)(H,26,29) |
| InChIKey | RMIOPSBRTDNXDJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|