C13H12N2O5S — CID 18807707
4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)propanoylamino]benzoic acid (PubChem CID 18807707) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)propanoylamino]benzoic acid.
| Compound Name | 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 18807707 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-[2-(2,4-dioxo-1,3-thiazolidin-5-yl)propanoylamino]benzoic acid |
| SMILES | CC(C(=O)Nc1ccc(C(=O)O)cc1)C1SC(=O)NC1=O |
| InChI | InChI=1S/C13H12N2O5S/c1-6(9-11(17)15-13(20)21-9)10(16)14-8-4-2-7(3-5-8)12(18)19/h2-6,9H,1H3,(H,14,16)(H,18,19)(H,15,17,20) |
| InChIKey | JGPGESGJZLBZQZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|