C21H16N4O2S3 — CID 18808165
(2E)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-3-phenylpropanamide (PubChem CID 18808165) has the molecular formula C21H16N4O2S3 and a molecular weight of 452.59 g/mol. Its IUPAC name is (2E)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-3-phenylpropanamide.
| Compound Name | (2E)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-3-phenylpropanamide |
|---|---|
| PubChem CID | 18808165 |
| Molecular Formula | C21H16N4O2S3 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (2E)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-3-phenylpropanamide |
| SMILES | Cc1nnc(NC(=O)/C(Cc2ccccc2)=C2/SC(=S)N(c3ccccc3)C2=O)s1 |
| InChI | InChI=1S/C21H16N4O2S3/c1-13-23-24-20(29-13)22-18(26)16(12-14-8-4-2-5-9-14)17-19(27)25(21(28)30-17)15-10-6-3-7-11-15/h2-11H,12H2,1H3,(H,22,24,26)/b17-16+ |
| InChIKey | FIRIOPWIDYCOKH-WUKNDPDISA-N |
| XLogP | 4.35 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|