C22H19N3O4 — CID 18809338
5-[5-(4-methylphenyl)furan-2-yl]-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 18809338) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 5-[5-(4-methylphenyl)furan-2-yl]-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 5-[5-(4-methylphenyl)furan-2-yl]-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 18809338 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 5-[5-(4-methylphenyl)furan-2-yl]-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | Cc1ccc(-c2ccc(C3C4=C(CCCC4=O)Nc4[nH]c(=O)[nH]c(=O)c43)o2)cc1 |
| InChI | InChI=1S/C22H19N3O4/c1-11-5-7-12(8-6-11)15-9-10-16(29-15)18-17-13(3-2-4-14(17)26)23-20-19(18)21(27)25-22(28)24-20/h5-10,18H,2-4H2,1H3,(H3,23,24,25,27,28) |
| InChIKey | BNGLZNFQMGVMGM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |