About 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine
7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine (PubChem CID 1881) has the molecular formula C15H19N5
and a molecular weight of 269.35 g/mol. Its IUPAC name is 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine.
Molecular Properties
| Compound Name | 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine |
| PubChem CID | 1881 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine |
| SMILES | CCC(CC)n1ccc2c3c(N)nc(N)nc3ccc21 |
| InChI | InChI=1S/C15H19N5/c1-3-9(4-2)20-8-7-10-12(20)6-5-11-13(10)14(16)19-15(17)18-11/h5-9H,3-4H2,1-2H3,(H4,16,17,18,19) |
| InChIKey | GCPJCLJGTVTGRF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine?
The IUPAC name of 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine (CID 1881) is 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine.
What is the SMILES notation for 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine?
The canonical SMILES for 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine is CCC(CC)n1ccc2c3c(N)nc(N)nc3ccc21.
What is the InChIKey of 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine?
The InChIKey is GCPJCLJGTVTGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5/c1-3-9(4-2)20-8-7-10-12(20)6-5-11-13(10)14(16)19-15(17)18-11/h5-9H,3-4H2,1-2H3,(H4,16,17,18,19).
What are the key properties of 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine?
7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine has a molecular weight of 269.35 g/mol, XLogP of 3.11, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pentan-3-ylpyrrolo[3,2-f]quinazoline-1,3-diamine is sourced from PubChem (CID 1881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).