C28H26Cl2N2O4 — CID 18811791
(4E)-5-(2,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 18811791) has the molecular formula C28H26Cl2N2O4 and a molecular weight of 525.43 g/mol. Its IUPAC name is (4E)-5-(2,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(2,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18811791 |
| Molecular Formula | C28H26Cl2N2O4 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | (4E)-5-(2,4-dichlorophenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CN(C)CCN1C(=O)C(=O)/C(=C(/O)c2ccc(OCc3ccccc3)cc2)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H26Cl2N2O4/c1-31(2)14-15-32-25(22-13-10-20(29)16-23(22)30)24(27(34)28(32)35)26(33)19-8-11-21(12-9-19)36-17-18-6-4-3-5-7-18/h3-13,16,25,33H,14-15,17H2,1-2H3/b26-24+ |
| InChIKey | WEPNIGMNFJKIFS-SHHOIMCASA-N |
| XLogP | 5.56 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|