C30H32N2O7S — CID 18812342
ethyl 2-[(3E)-2-(4-ethoxyphenyl)-3-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 18812342) has the molecular formula C30H32N2O7S and a molecular weight of 564.66 g/mol. Its IUPAC name is ethyl 2-[(3E)-2-(4-ethoxyphenyl)-3-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(3E)-2-(4-ethoxyphenyl)-3-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18812342 |
| Molecular Formula | C30H32N2O7S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | ethyl 2-[(3E)-2-(4-ethoxyphenyl)-3-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OCC(C)C)cc3)C2c2ccc(OCC)cc2)nc1C |
| InChI | InChI=1S/C30H32N2O7S/c1-6-37-21-12-8-19(9-13-21)24-23(25(33)20-10-14-22(15-11-20)39-16-17(3)4)26(34)28(35)32(24)30-31-18(5)27(40-30)29(36)38-7-2/h8-15,17,24,33H,6-7,16H2,1-5H3/b25-23+ |
| InChIKey | MJDDGJCUPMEKBT-WJTDDFOZSA-N |
| XLogP | 5.69 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|