C28H22FN3O5S2 — CID 18813498
(4Z)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 18813498) has the molecular formula C28H22FN3O5S2 and a molecular weight of 563.63 g/mol. Its IUPAC name is (4Z)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18813498 |
| Molecular Formula | C28H22FN3O5S2 |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | (4Z)-1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(/O)c3ccc(F)cc3)C(=O)C(=O)N2c2nnc(SCc3ccccc3)s2)cc1OC |
| InChI | InChI=1S/C28H22FN3O5S2/c1-36-20-13-10-18(14-21(20)37-2)23-22(24(33)17-8-11-19(29)12-9-17)25(34)26(35)32(23)27-30-31-28(39-27)38-15-16-6-4-3-5-7-16/h3-14,23,33H,15H2,1-2H3/b24-22- |
| InChIKey | JHAQFZWVRXOVBQ-GYHWCHFESA-N |
| XLogP | 5.61 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|