C28H21ClN4O4S2 — CID 18814622
(4E)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 18814622) has the molecular formula C28H21ClN4O4S2 and a molecular weight of 577.09 g/mol. Its IUPAC name is (4E)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18814622 |
| Molecular Formula | C28H21ClN4O4S2 |
| Molecular Weight | 577.09 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | (4E)-1-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | CC1Cc2cc(/C(O)=C3\C(=O)C(=O)N(c4nnc(SCc5ccccc5Cl)s4)C3c3cccnc3)ccc2O1 |
| InChI | InChI=1S/C28H21ClN4O4S2/c1-15-11-19-12-16(8-9-21(19)37-15)24(34)22-23(17-6-4-10-30-13-17)33(26(36)25(22)35)27-31-32-28(39-27)38-14-18-5-2-3-7-20(18)29/h2-10,12-13,15,23,34H,11,14H2,1H3/b24-22+ |
| InChIKey | UWCAOMMBFCYCJI-ZNTNEXAZSA-N |
| XLogP | 5.83 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.09 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|