C30H26FN3O3S2 — CID 18815103
(4Z)-5-(4-tert-butylphenyl)-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 18815103) has the molecular formula C30H26FN3O3S2 and a molecular weight of 559.69 g/mol. Its IUPAC name is (4Z)-5-(4-tert-butylphenyl)-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(4-tert-butylphenyl)-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18815103 |
| Molecular Formula | C30H26FN3O3S2 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | (4Z)-5-(4-tert-butylphenyl)-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CC(C)(C)c1ccc(C2/C(=C(/O)c3ccccc3)C(=O)C(=O)N2c2nnc(SCc3ccccc3F)s2)cc1 |
| InChI | InChI=1S/C30H26FN3O3S2/c1-30(2,3)21-15-13-18(14-16-21)24-23(25(35)19-9-5-4-6-10-19)26(36)27(37)34(24)28-32-33-29(39-28)38-17-20-11-7-8-12-22(20)31/h4-16,24,35H,17H2,1-3H3/b25-23- |
| InChIKey | AIGNBOGWCLMEEE-BZZOAKBMSA-N |
| XLogP | 6.89 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|