C29H23BrFN3O6S2 — CID 18815248
(4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 18815248) has the molecular formula C29H23BrFN3O6S2 and a molecular weight of 672.55 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18815248 |
| Molecular Formula | C29H23BrFN3O6S2 |
| Molecular Weight | 672.55 g/mol |
| Exact Mass | 671.02 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)-hydroxymethylidene]-1-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(/O)c3ccc(Br)cc3)C(=O)C(=O)N2c2nnc(SCc3ccccc3F)s2)cc(OC)c1OC |
| InChI | InChI=1S/C29H23BrFN3O6S2/c1-38-20-12-17(13-21(39-2)26(20)40-3)23-22(24(35)15-8-10-18(30)11-9-15)25(36)27(37)34(23)28-32-33-29(42-28)41-14-16-6-4-5-7-19(16)31/h4-13,23,35H,14H2,1-3H3/b24-22- |
| InChIKey | XHNUWDDDKPAFHT-GYHWCHFESA-N |
| XLogP | 6.38 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|