C29H25N3O3S2 — CID 18817440
(5E)-5-[[2-(2,3-dimethylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methylphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18817440) has the molecular formula C29H25N3O3S2 and a molecular weight of 527.67 g/mol. Its IUPAC name is (5E)-5-[[2-(2,3-dimethylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methylphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(2,3-dimethylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methylphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18817440 |
| Molecular Formula | C29H25N3O3S2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | (5E)-5-[[2-(2,3-dimethylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methylphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(CN2C(=O)/C(=C\c3c(Oc4cccc(C)c4C)nc4c(C)cccn4c3=O)SC2=S)cc1 |
| InChI | InChI=1S/C29H25N3O3S2/c1-17-10-12-21(13-11-17)16-32-28(34)24(37-29(32)36)15-22-26(35-23-9-5-7-18(2)20(23)4)30-25-19(3)8-6-14-31(25)27(22)33/h5-15H,16H2,1-4H3/b24-15+ |
| InChIKey | MMQDNKYCOBWGQM-BUVRLJJBSA-N |
| XLogP | 6.12 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|