C36H36N6O4S2 — CID 18821568
3-[4-[(Z)-[2-[(E)-2-(4-butoxyphenyl)ethenyl]-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 18821568) has the molecular formula C36H36N6O4S2 and a molecular weight of 680.86 g/mol. Its IUPAC name is 3-[4-[(Z)-[2-[(E)-2-(4-butoxyphenyl)ethenyl]-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[4-[(Z)-[2-[(E)-2-(4-butoxyphenyl)ethenyl]-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 18821568 |
| Molecular Formula | C36H36N6O4S2 |
| Molecular Weight | 680.86 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | 3-[4-[(Z)-[2-[(E)-2-(4-butoxyphenyl)ethenyl]-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCCCOc1ccc(/C=C/c2nc3s/c(=C\c4cn(-c5ccccc5)nc4-c4cccc(S(=O)(=O)N(CC)CC)c4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C36H36N6O4S2/c1-4-7-22-46-30-19-16-26(17-20-30)18-21-33-37-36-42(38-33)35(43)32(47-36)24-28-25-41(29-13-9-8-10-14-29)39-34(28)27-12-11-15-31(23-27)48(44,45)40(5-2)6-3/h8-21,23-25H,4-7,22H2,1-3H3/b21-18+,32-24- |
| InChIKey | ZKQGSCZGNIBJCH-LROJMKIUSA-N |
| XLogP | 5.93 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.86 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|