C29H35N5O2 — CID 18822601
6-imino-11-methyl-N-octyl-2-oxo-7-(1-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18822601) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 6-imino-11-methyl-N-octyl-2-oxo-7-(1-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 6-imino-11-methyl-N-octyl-2-oxo-7-(1-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18822601 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 6-imino-11-methyl-N-octyl-2-oxo-7-(1-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)NCCCCCCCC)cc2c(=O)n3cccc(C)c3nc2n1C(C)c1ccccc1 |
| InChI | InChI=1S/C29H35N5O2/c1-4-5-6-7-8-12-17-31-28(35)23-19-24-27(32-26-20(2)14-13-18-33(26)29(24)36)34(25(23)30)21(3)22-15-10-9-11-16-22/h9-11,13-16,18-19,21,30H,4-8,12,17H2,1-3H3,(H,31,35)/b30-25+ |
| InChIKey | OEEKMFXRAQXESM-QCWLDUFUSA-N |
| XLogP | 5.14 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|