C23H29NO11 — CID 18823299
[3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-(4-methylphenoxy)acetate (PubChem CID 18823299) has the molecular formula C23H29NO11 and a molecular weight of 495.48 g/mol. Its IUPAC name is [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-(4-methylphenoxy)acetate.
| Compound Name | [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-(4-methylphenoxy)acetate |
|---|---|
| PubChem CID | 18823299 |
| Molecular Formula | C23H29NO11 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 2-(4-methylphenoxy)acetate |
| SMILES | CC(=O)NC1C(OC(=O)COc2ccc(C)cc2)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H29NO11/c1-12-6-8-17(9-7-12)31-11-19(29)35-23-20(24-13(2)25)22(33-16(5)28)21(32-15(4)27)18(34-23)10-30-14(3)26/h6-9,18,20-23H,10-11H2,1-5H3,(H,24,25) |
| InChIKey | KWEDVGSXKYMFRW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|