C22H28FNO3 — CID 18823969
2-[4-(2-ethylhexoxy)phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 18823969) has the molecular formula C22H28FNO3 and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-[4-(2-ethylhexoxy)phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-(2-ethylhexoxy)phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18823969 |
| Molecular Formula | C22H28FNO3 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 2-[4-(2-ethylhexoxy)phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCCCC(CC)COc1ccc(OCC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H28FNO3/c1-3-5-6-17(4-2)15-26-20-11-13-21(14-12-20)27-16-22(25)24-19-9-7-18(23)8-10-19/h7-14,17H,3-6,15-16H2,1-2H3,(H,24,25) |
| InChIKey | VNXGLWSVEDEDSG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |