C21H15FN2O3S — CID 18826756
4-(benzenesulfonyl)-2-(2-fluorophenyl)-N-phenyl-1,3-oxazol-5-amine (PubChem CID 18826756) has the molecular formula C21H15FN2O3S and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2-(2-fluorophenyl)-N-phenyl-1,3-oxazol-5-amine.
| Compound Name | 4-(benzenesulfonyl)-2-(2-fluorophenyl)-N-phenyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18826756 |
| Molecular Formula | C21H15FN2O3S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-(benzenesulfonyl)-2-(2-fluorophenyl)-N-phenyl-1,3-oxazol-5-amine |
| SMILES | O=S(=O)(c1ccccc1)c1nc(-c2ccccc2F)oc1Nc1ccccc1 |
| InChI | InChI=1S/C21H15FN2O3S/c22-18-14-8-7-13-17(18)19-24-21(28(25,26)16-11-5-2-6-12-16)20(27-19)23-15-9-3-1-4-10-15/h1-14,23H |
| InChIKey | XXXLQOMLTZVQBP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |