C17H19N5O — CID 18827271
4,5-dicyano-N-ethyl-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 18827271) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 4,5-dicyano-N-ethyl-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | 4,5-dicyano-N-ethyl-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 18827271 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4,5-dicyano-N-ethyl-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CCNC(=O)C12CCC(C)(c3nc(C#N)c(C#N)nc31)C2(C)C |
| InChI | InChI=1S/C17H19N5O/c1-5-20-14(23)17-7-6-16(4,15(17,2)3)12-13(17)22-11(9-19)10(8-18)21-12/h5-7H2,1-4H3,(H,20,23) |
| InChIKey | PDSLYRIBELMCKS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |