C28H27N3O7 — CID 18828136
(4E)-4-[hydroxy-(6-methoxynaphthalen-2-yl)methylidene]-1-(2-morpholin-4-ylethyl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 18828136) has the molecular formula C28H27N3O7 and a molecular weight of 517.54 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(6-methoxynaphthalen-2-yl)methylidene]-1-(2-morpholin-4-ylethyl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(6-methoxynaphthalen-2-yl)methylidene]-1-(2-morpholin-4-ylethyl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 18828136 |
| Molecular Formula | C28H27N3O7 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | (4E)-4-[hydroxy-(6-methoxynaphthalen-2-yl)methylidene]-1-(2-morpholin-4-ylethyl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2cc(/C(O)=C3\C(=O)C(=O)N(CCN4CCOCC4)C3c3ccc([N+](=O)[O-])cc3)ccc2c1 |
| InChI | InChI=1S/C28H27N3O7/c1-37-23-9-6-19-16-21(3-2-20(19)17-23)26(32)24-25(18-4-7-22(8-5-18)31(35)36)30(28(34)27(24)33)11-10-29-12-14-38-15-13-29/h2-9,16-17,25,32H,10-15H2,1H3/b26-24+ |
| InChIKey | OGNQSTLANGGGDK-SHHOIMCASA-N |
| XLogP | 3.51 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|