C17H30N2O4 — CID 18830153
(3E)-3-hydroxyimino-N,N-bis(2-methoxyethyl)-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 18830153) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is (3E)-3-hydroxyimino-N,N-bis(2-methoxyethyl)-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (3E)-3-hydroxyimino-N,N-bis(2-methoxyethyl)-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 18830153 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (3E)-3-hydroxyimino-N,N-bis(2-methoxyethyl)-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | COCCN(CCOC)C(=O)C12CCC(C)(/C(=N/O)C1)C2(C)C |
| InChI | InChI=1S/C17H30N2O4/c1-15(2)16(3)6-7-17(15,12-13(16)18-21)14(20)19(8-10-22-4)9-11-23-5/h21H,6-12H2,1-5H3/b18-13+ |
| InChIKey | LSHYEBNSRGCLQS-QGOAFFKASA-N |
| XLogP | 2.15 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|