C11H10Cl2N4OS — CID 18830442
2-[5-[(3,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazol-2-yl]guanidine (PubChem CID 18830442) has the molecular formula C11H10Cl2N4OS and a molecular weight of 317.20 g/mol. Its IUPAC name is 2-[5-[(3,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[5-[(3,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 18830442 |
| Molecular Formula | C11H10Cl2N4OS |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 2-[5-[(3,5-dichlorophenyl)methyl]-4-oxo-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=NC1=NC(=O)C(Cc2cc(Cl)cc(Cl)c2)S1 |
| InChI | InChI=1S/C11H10Cl2N4OS/c12-6-1-5(2-7(13)4-6)3-8-9(18)16-11(19-8)17-10(14)15/h1-2,4,8H,3H2,(H4,14,15,16,17,18) |
| InChIKey | JVNMPBSDSVTWKA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|