C17H18N3S+ — CID 18830752
N,N-dimethyl-3-(4-methylphenyl)-2-phenyl-1,2,4-thiadiazol-2-ium-5-amine (PubChem CID 18830752) has the molecular formula C17H18N3S+ and a molecular weight of 296.42 g/mol. Its IUPAC name is N,N-dimethyl-3-(4-methylphenyl)-2-phenyl-1,2,4-thiadiazol-2-ium-5-amine.
| Compound Name | N,N-dimethyl-3-(4-methylphenyl)-2-phenyl-1,2,4-thiadiazol-2-ium-5-amine |
|---|---|
| PubChem CID | 18830752 |
| Molecular Formula | C17H18N3S+ |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N,N-dimethyl-3-(4-methylphenyl)-2-phenyl-1,2,4-thiadiazol-2-ium-5-amine |
| SMILES | Cc1ccc(-c2nc(N(C)C)s[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N3S/c1-13-9-11-14(12-10-13)16-18-17(19(2)3)21-20(16)15-7-5-4-6-8-15/h4-12H,1-3H3/q+1 |
| InChIKey | JYFHBCHNSXUTMO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|