C23H25NO3 — CID 18830852
N-benzyl-2-(3,5-dimethylphenoxy)-N-(furan-2-ylmethyl)propanamide (PubChem CID 18830852) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-benzyl-2-(3,5-dimethylphenoxy)-N-(furan-2-ylmethyl)propanamide.
| Compound Name | N-benzyl-2-(3,5-dimethylphenoxy)-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 18830852 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-benzyl-2-(3,5-dimethylphenoxy)-N-(furan-2-ylmethyl)propanamide |
| SMILES | Cc1cc(C)cc(OC(C)C(=O)N(Cc2ccccc2)Cc2ccco2)c1 |
| InChI | InChI=1S/C23H25NO3/c1-17-12-18(2)14-22(13-17)27-19(3)23(25)24(16-21-10-7-11-26-21)15-20-8-5-4-6-9-20/h4-14,19H,15-16H2,1-3H3 |
| InChIKey | DGSQPGVYOADKIW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |