C23H24N2O2 — CID 18830895
N-benzyl-2-(3,4-dimethylphenoxy)-N-pyridin-2-ylpropanamide (PubChem CID 18830895) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-benzyl-2-(3,4-dimethylphenoxy)-N-pyridin-2-ylpropanamide.
| Compound Name | N-benzyl-2-(3,4-dimethylphenoxy)-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 18830895 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-benzyl-2-(3,4-dimethylphenoxy)-N-pyridin-2-ylpropanamide |
| SMILES | Cc1ccc(OC(C)C(=O)N(Cc2ccccc2)c2ccccn2)cc1C |
| InChI | InChI=1S/C23H24N2O2/c1-17-12-13-21(15-18(17)2)27-19(3)23(26)25(22-11-7-8-14-24-22)16-20-9-5-4-6-10-20/h4-15,19H,16H2,1-3H3 |
| InChIKey | AANNLQLJJPFFOB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |