C14H20N2O3 — CID 18832067
N',N',3,6,6-pentamethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 18832067) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N',N',3,6,6-pentamethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | N',N',3,6,6-pentamethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 18832067 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N',N',3,6,6-pentamethyl-4-oxo-5,7-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NN(C)C)oc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C14H20N2O3/c1-8-11-9(17)6-14(2,3)7-10(11)19-12(8)13(18)15-16(4)5/h6-7H2,1-5H3,(H,15,18) |
| InChIKey | BAIJCUJYMPNFMQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|