C23H17F3N4O2 — CID 18832369
N'-phenyl-4-[3-(trifluoromethyl)-4,5-dihydrofuro[2,3-g]indazol-1-yl]benzohydrazide (PubChem CID 18832369) has the molecular formula C23H17F3N4O2 and a molecular weight of 438.41 g/mol. Its IUPAC name is N'-phenyl-4-[3-(trifluoromethyl)-4,5-dihydrofuro[2,3-g]indazol-1-yl]benzohydrazide.
| Compound Name | N'-phenyl-4-[3-(trifluoromethyl)-4,5-dihydrofuro[2,3-g]indazol-1-yl]benzohydrazide |
|---|---|
| PubChem CID | 18832369 |
| Molecular Formula | C23H17F3N4O2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N'-phenyl-4-[3-(trifluoromethyl)-4,5-dihydrofuro[2,3-g]indazol-1-yl]benzohydrazide |
| SMILES | O=C(NNc1ccccc1)c1ccc(-n2nc(C(F)(F)F)c3c2-c2ccoc2CC3)cc1 |
| InChI | InChI=1S/C23H17F3N4O2/c24-23(25,26)21-18-10-11-19-17(12-13-32-19)20(18)30(29-21)16-8-6-14(7-9-16)22(31)28-27-15-4-2-1-3-5-15/h1-9,12-13,27H,10-11H2,(H,28,31) |
| InChIKey | YTJFGRSMYXFSAX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|