About 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile
2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile (PubChem CID 18833276) has the molecular formula C16H13F3N2OS
and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile |
| PubChem CID | 18833276 |
| Molecular Formula | C16H13F3N2OS |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile |
| SMILES | CCCSc1nc2c(c(C(F)(F)F)c1C#N)CCc1occc1-2 |
| InChI | InChI=1S/C16H13F3N2OS/c1-2-7-23-15-11(8-20)13(16(17,18)19)10-3-4-12-9(5-6-22-12)14(10)21-15/h5-6H,2-4,7H2,1H3 |
| InChIKey | KQFGIBAGGDIXSS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile?
The IUPAC name of 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile (CID 18833276) is 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile.
What is the SMILES notation for 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile?
The canonical SMILES for 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile is CCCSc1nc2c(c(C(F)(F)F)c1C#N)CCc1occc1-2.
What is the InChIKey of 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile?
The InChIKey is KQFGIBAGGDIXSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N2OS/c1-2-7-23-15-11(8-20)13(16(17,18)19)10-3-4-12-9(5-6-22-12)14(10)21-15/h5-6H,2-4,7H2,1H3.
What are the key properties of 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile?
2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile has a molecular weight of 338.35 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfanyl-4-(trifluoromethyl)-5,6-dihydrofuro[2,3-h]quinoline-3-carbonitrile is sourced from PubChem (CID 18833276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).