C27H28N2O2 — CID 18833399
[(E)-[2,6,6-trimethyl-1-(4-methylphenyl)-5,7-dihydroindol-4-ylidene]amino] (E)-3-phenylprop-2-enoate (PubChem CID 18833399) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is [(E)-[2,6,6-trimethyl-1-(4-methylphenyl)-5,7-dihydroindol-4-ylidene]amino] (E)-3-phenylprop-2-enoate.
| Compound Name | [(E)-[2,6,6-trimethyl-1-(4-methylphenyl)-5,7-dihydroindol-4-ylidene]amino] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 18833399 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [(E)-[2,6,6-trimethyl-1-(4-methylphenyl)-5,7-dihydroindol-4-ylidene]amino] (E)-3-phenylprop-2-enoate |
| SMILES | Cc1ccc(-n2c(C)cc3c2CC(C)(C)C/C3=N\OC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N2O2/c1-19-10-13-22(14-11-19)29-20(2)16-23-24(17-27(3,4)18-25(23)29)28-31-26(30)15-12-21-8-6-5-7-9-21/h5-16H,17-18H2,1-4H3/b15-12+,28-24+ |
| InChIKey | YIKDBXJENSJSNX-OKKAVSODSA-N |
| XLogP | 6.03 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|