C22H21ClN2O2S — CID 18833480
[(E)-[1-(4-chlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] thiophene-2-carboxylate (PubChem CID 18833480) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is [(E)-[1-(4-chlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] thiophene-2-carboxylate.
| Compound Name | [(E)-[1-(4-chlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18833480 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [(E)-[1-(4-chlorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-ylidene]amino] thiophene-2-carboxylate |
| SMILES | Cc1cc2c(n1-c1ccc(Cl)cc1)CC(C)(C)C/C2=N\OC(=O)c1cccs1 |
| InChI | InChI=1S/C22H21ClN2O2S/c1-14-11-17-18(24-27-21(26)20-5-4-10-28-20)12-22(2,3)13-19(17)25(14)16-8-6-15(23)7-9-16/h4-11H,12-13H2,1-3H3/b24-18+ |
| InChIKey | NPDWVQNBOUDUNV-HKOYGPOVSA-N |
| XLogP | 6.03 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|