C20H14N2O4 — CID 18833832
2-methyl-4,9-dioxo-N-(pyridin-4-ylmethyl)benzo[f][1]benzofuran-3-carboxamide (PubChem CID 18833832) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-methyl-4,9-dioxo-N-(pyridin-4-ylmethyl)benzo[f][1]benzofuran-3-carboxamide.
| Compound Name | 2-methyl-4,9-dioxo-N-(pyridin-4-ylmethyl)benzo[f][1]benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 18833832 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-methyl-4,9-dioxo-N-(pyridin-4-ylmethyl)benzo[f][1]benzofuran-3-carboxamide |
| SMILES | Cc1oc2c(c1C(=O)NCc1ccncc1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H14N2O4/c1-11-15(20(25)22-10-12-6-8-21-9-7-12)16-17(23)13-4-2-3-5-14(13)18(24)19(16)26-11/h2-9H,10H2,1H3,(H,22,25) |
| InChIKey | WDNKSUCCDFCITQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|