About pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate
pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 18834459) has the molecular formula C15H15NO4
and a molecular weight of 273.29 g/mol. Its IUPAC name is pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate.
Molecular Properties
| Compound Name | pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
| PubChem CID | 18834459 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)C2CCC1(C(=O)Oc1cccnc1)C(=O)C2=O |
| InChI | InChI=1S/C15H15NO4/c1-14(2)10-5-6-15(14,12(18)11(10)17)13(19)20-9-4-3-7-16-8-9/h3-4,7-8,10H,5-6H2,1-2H3 |
| InChIKey | XQXDALQIXYTTJZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate?
The IUPAC name of pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate (CID 18834459) is pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate.
What is the SMILES notation for pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate?
The canonical SMILES for pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate is CC1(C)C2CCC1(C(=O)Oc1cccnc1)C(=O)C2=O.
What is the InChIKey of pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate?
The InChIKey is XQXDALQIXYTTJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4/c1-14(2)10-5-6-15(14,12(18)11(10)17)13(19)20-9-4-3-7-16-8-9/h3-4,7-8,10H,5-6H2,1-2H3.
What are the key properties of pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate?
pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate has a molecular weight of 273.29 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-carboxylate is sourced from PubChem (CID 18834459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).