C29H21Cl2N3O2 — CID 18834749
[4-(4-cyanophenyl)phenyl] 6,7-dichloro-15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate (PubChem CID 18834749) has the molecular formula C29H21Cl2N3O2 and a molecular weight of 514.41 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 6,7-dichloro-15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 6,7-dichloro-15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 18834749 |
| Molecular Formula | C29H21Cl2N3O2 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 6,7-dichloro-15,15-dimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate |
| SMILES | CC1(C)C2CCC1(C(=O)Oc1ccc(-c3ccc(C#N)cc3)cc1)c1nc3cc(Cl)c(Cl)cc3nc12 |
| InChI | InChI=1S/C29H21Cl2N3O2/c1-28(2)20-11-12-29(28,26-25(20)33-23-13-21(30)22(31)14-24(23)34-26)27(35)36-19-9-7-18(8-10-19)17-5-3-16(15-32)4-6-17/h3-10,13-14,20H,11-12H2,1-2H3 |
| InChIKey | VOQLKSVLVKNGSL-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|