C20H17N5O — CID 18834892
4,5-dicyano-11,11-dimethyl-N-phenyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 18834892) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 4,5-dicyano-11,11-dimethyl-N-phenyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | 4,5-dicyano-11,11-dimethyl-N-phenyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 18834892 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4,5-dicyano-11,11-dimethyl-N-phenyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CC1(C)C2CCC1(C(=O)Nc1ccccc1)c1nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C20H17N5O/c1-19(2)13-8-9-20(19,18(26)23-12-6-4-3-5-7-12)17-16(13)24-14(10-21)15(11-22)25-17/h3-7,13H,8-9H2,1-2H3,(H,23,26) |
| InChIKey | LJONAIPFVLGAHK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |