C19H18ClF3N2O3 — CID 18835085
(4Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 18835085) has the molecular formula C19H18ClF3N2O3 and a molecular weight of 414.81 g/mol. Its IUPAC name is (4Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | (4Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18835085 |
| Molecular Formula | C19H18ClF3N2O3 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (4Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)oc2c1/C(=N\O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H18ClF3N2O3/c1-9-15-13(25-27)7-18(2,3)8-14(15)28-16(9)17(26)24-12-6-10(19(21,22)23)4-5-11(12)20/h4-6,27H,7-8H2,1-3H3,(H,24,26)/b25-13- |
| InChIKey | WBSCNTOOHAAOMN-MXAYSNPKSA-N |
| XLogP | 5.66 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|