C22H25FN2O3 — CID 18835088
(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-[(4Z)-4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-yl]methanone (PubChem CID 18835088) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is (6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-[(4Z)-4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-yl]methanone.
| Compound Name | (6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-[(4Z)-4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-yl]methanone |
|---|---|
| PubChem CID | 18835088 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-[(4Z)-4-hydroxyimino-3,6,6-trimethyl-5,7-dihydro-1-benzofuran-2-yl]methanone |
| SMILES | Cc1c(C(=O)N2c3ccc(F)cc3CCC2C)oc2c1/C(=N\O)CC(C)(C)C2 |
| InChI | InChI=1S/C22H25FN2O3/c1-12-5-6-14-9-15(23)7-8-17(14)25(12)21(26)20-13(2)19-16(24-27)10-22(3,4)11-18(19)28-20/h7-9,12,27H,5-6,10-11H2,1-4H3/b24-16- |
| InChIKey | MJYFRRZNKLHRKQ-JLPGSUDCSA-N |
| XLogP | 4.86 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|