C19H28N4O2S — CID 18835532
[(Z)-[3,6,6-trimethyl-2-(2-methylpiperidine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]thiourea (PubChem CID 18835532) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is [(Z)-[3,6,6-trimethyl-2-(2-methylpiperidine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]thiourea.
| Compound Name | [(Z)-[3,6,6-trimethyl-2-(2-methylpiperidine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 18835532 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [(Z)-[3,6,6-trimethyl-2-(2-methylpiperidine-1-carbonyl)-5,7-dihydro-1-benzofuran-4-ylidene]amino]thiourea |
| SMILES | Cc1c(C(=O)N2CCCCC2C)oc2c1/C(=N\NC(N)=S)CC(C)(C)C2 |
| InChI | InChI=1S/C19H28N4O2S/c1-11-7-5-6-8-23(11)17(24)16-12(2)15-13(21-22-18(20)26)9-19(3,4)10-14(15)25-16/h11H,5-10H2,1-4H3,(H3,20,22,26)/b21-13- |
| InChIKey | WKRWTPXURKFRMB-BKUYFWCQSA-N |
| XLogP | 3.11 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|